A3964512
Ethylenediaminetetraacetic Acid Tetrasodium Salt Dihydrate , AR,99.0-102.0%(T) , 10378-23-1
Synonym(s):
Edathamil;EDTA tetrasodium salt;Tetrasodium ethylenediaminetetraacetate dihydrate
CAS NO.:10378-23-1
Empirical Formula: C10H16N2Na4O10
Molecular Weight: 416.2
MDL number: MFCD00007499
EINECS: 600-485-4
| Pack Size | Price | Stock | Quantity |
| 25G | RMB23.20 | In Stock |
|
| 100G | RMB28.80 | In Stock |
|
| 500G | RMB62.40 | In Stock |
|
| 2.5KG | RMB287.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300°C |
| Flash point: | 350°C |
| storage temp. | room temp |
| solubility | H2O: clear, colorless |
| form | Liquid |
| color | Yellow-Orange |
| PH | 10.5-11.5 (50g/l, H2O, 20℃) |
| Water Solubility | almost transparency |
| BRN | 3861753 |
| InChI | InChI=1S/C10H16N2O8.Na.H2O.H/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;1H2; |
| InChIKey | LHCZUGDUAQREMU-UHFFFAOYSA-N |
| SMILES | N(CC(=O)O)(CC(=O)O)CCN(CC(=O)O)CC(=O)O.[NaH].O |
| CAS DataBase Reference | 10378-23-1(CAS DataBase Reference) |
Description and Uses
Used to eliminate enzyme inhibition by traces of heavy metals, and to inhibit enzymes that require divalent cations as cofactors.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302+H332-H318-H373 |
| Precautionary statements | P260-P280-P301+P312-P304+P340+P312-P305+P351+P338-P314 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-41-22 |
| Safety Statements | 26-36/37-46-39 |
| WGK Germany | 3 |
| RTECS | DB6145180 |
| TSCA | Yes |
| HS Code | 29224995 |







