A3964612
2-Ethoxy-1-ethoxycarbonyl-1,2-dihydroquinoline , 99% , 16357-59-8
Synonym(s):
N-Ethoxycarbonyl-2-ethoxy-1,2-dihydroquinoline;EEDQ;Ethyl 1,2-dihydro-2-ethoxyquinoline-1-carboxylate
CAS NO.:16357-59-8
Empirical Formula: C14H17NO3
Molecular Weight: 247.29
MDL number: MFCD00006703
EINECS: 240-418-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB37.60 | In Stock |
|
| 100G | RMB135.20 | In Stock |
|
| 500G | RMB663.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 62-67 °C(lit.) |
| Boiling point: | 125-128 °C (0.1 mmHg) |
| Density | 1.1173 (rough estimate) |
| refractive index | 1.5300 (estimate) |
| Flash point: | 125-128°C/0.1mm |
| storage temp. | 2-8°C |
| solubility | Chlorofrom (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| pka | -1.27±0.40(Predicted) |
| form | Crystalline Powder |
| color | White to beige |
| Water Solubility | insoluble |
| Sensitive | Moisture Sensitive |
| Merck | 14,3518 |
| BRN | 533048 |
| Major Application | peptide synthesis |
| InChI | 1S/C14H17NO3/c1-3-17-13-10-9-11-7-5-6-8-12(11)15(13)14(16)18-4-2/h5-10,13H,3-4H2,1-2H3 |
| InChIKey | GKQLYSROISKDLL-UHFFFAOYSA-N |
| SMILES | CCOC1C=Cc2ccccc2N1C(=O)OCC |
| CAS DataBase Reference | 16357-59-8(CAS DataBase Reference) |
| EPA Substance Registry System | 1(2H)-Quinolinecarboxylic acid, 2-ethoxy-, ethyl ester (16357-59-8) |
Description and Uses
2-Ethoxy-1-ethoxycarbonyl-1,2-dihydroquinoline is an irreversible membrane-bound receptor antagonist. It is used in synthetic chemistry, discovery, process R&D. It also acts as coupling reagents.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 38-36/37/38-20/21/22 |
| Safety Statements | 22-24/25-36/37/39-26-36 |
| WGK Germany | 3 |
| RTECS | VB2010000 |
| F | 9-21 |
| TSCA | TSCA listed |
| HS Code | 29334990 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | mouse,LD50,intraperitoneal,32mg/kg (32mg/kg),Journal of Medicinal Chemistry. Vol. 14, Pg. 49, 1971. |




