BD8919031
Ethyl 5,5-diphenyl-4,5-dihydroisoxazole-3-carboxylate , 97% , 163520-33-0
Synonym(s):
Ethyl 4,5-dihydro-5,5-diphenylisoxazol-3-carboxylate
CAS NO.:163520-33-0
Empirical Formula: C18H17NO3
Molecular Weight: 295.33
MDL number: MFCD03792846
EINECS: 443-870-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB58.40 | In Stock |
|
| 5g | RMB124.80 | In Stock |
|
| 10g | RMB187.20 | In Stock |
|
| 25g | RMB374.40 | In Stock |
|
| 100g | RMB936.00 | In Stock |
|
| 500g | RMB2808.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 87-88℃ (ethyl ether ) |
| Boiling point: | 407.7±55.0 °C(Predicted) |
| Density | 1.15±0.1 g/cm3 (20 ºC 760 Torr) |
| vapor pressure | 0Pa at 20℃ |
| storage temp. | Sealed in dry,Room Temperature |
| form | Solid |
| color | White to Almost white |
| Water Solubility | 1.06mg/L at 20℃ |
| Major Application | agriculture environmental |
| InChI | InChI=1S/C18H17NO3/c1-2-21-17(20)16-13-18(22-19-16,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12H,2,13H2,1H3 |
| InChIKey | MWKVXOJATACCCH-UHFFFAOYSA-N |
| SMILES | O1C(C2=CC=CC=C2)(C2=CC=CC=C2)CC(C(OCC)=O)=N1 |
| LogP | 3.8 at 30℃ |
| EPA Substance Registry System | Isoxadifen-ethyl (163520-33-0) |
Description and Uses
Isoxadifen-ethyl is a particularly useful pesticide.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H317-H410 |
| Precautionary statements | P261-P264-P273-P280-P301+P312-P302+P352 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,N |
| Risk Statements | 22-43-50-50/53 |
| Safety Statements | 36/37-61-60-22 |
| RIDADR | UN3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | NY2390000 |
| TSCA | TSCA listed |
| HS Code | 2934.99.1800 |
| HazardClass | 9 |
| PackingGroup | III |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Skin Sens. 1 |




