A3979712
Ethirimol , Analysis standard , 23947-60-6
CAS NO.：23947-60-6
Empirical Formula: C11H19N3O
Molecular Weight: 209.29
MDL number: MFCD00055519
EINECS: 245-949-3
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 159-160° |
| Boiling point: | 348.66°C (rough estimate) |
| Density | 1.2100 |
| vapor pressure | 2.7 x 10-4 Pa at 25 °C |
| refractive index | 1.5700 (estimate) |
| storage temp. | -20°C Freezer |
| solubility | Chloroform (Sparingly), Ethanol (Slightly), Methanol (Slightly) |
| pka | 5 |
| Water Solubility | 253 mg l-1 (pH 5.2), 150 mg l-1 (pH 7.3),
153 mg l-1 (pH 9.3) at 20 °C |
| color | White to Off-White |
| Merck | 13,3776 |
| BRN | 882476 |
| Major Application | agriculture environmental |
| InChI | InChI=1S/C11H19N3O/c1-4-6-7-9-8(3)13-11(12-5-2)14-10(9)15/h4-7H2,1-3H3,(H2,12,13,14,15) |
| InChIKey | BBXXLROWFHWFQY-UHFFFAOYSA-N |
| SMILES | C1(NCC)=NC(C)=C(CCCC)C(=O)N1 |
| EPA Substance Registry System | Ethirimol (23947-60-6) |
Description and Uses
Ethirimol is a pyrimidine based fungicide with wide applications such as controlling leaf spot of sugar beet.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H312 |
| Precautionary statements | P280-P302+P352+P312-P362+P364-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 21 |
| Safety Statements | 36/37 |
| WGK Germany | 1 |
| RTECS | UW7380000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal |
| Toxicity | LD50 orally in rats: 4000 mg/kg (Bebbington) |
