A3981312
Ethylenebis(nitrilodimethylene)tetraphosphonic acid , 98% , 1429-50-1
CAS NO.:1429-50-1
Empirical Formula: C6H20N2O12P4
Molecular Weight: 436.12
MDL number: MFCD00058893
EINECS: 215-851-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB37.60 | In Stock |
|
| 25G | RMB109.60 | In Stock |
|
| 100G | RMB268.00 | In Stock |
|
| 500G | RMB559.20 | In Stock |
|
| 2.5kg | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 247 °C |
| Boiling point: | 878.7±75.0 °C(Predicted) |
| Density | 1.993±0.06 g/cm3(Predicted) |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | Aqueous Base (Slightly) |
| form | Solid |
| pka | 0.13±0.10(Predicted) |
| color | White |
| Water Solubility | 19.6g/L at 20℃ |
| InChI | InChI=1S/C6H20N2O12P4/c9-21(10,11)3-7(4-22(12,13)14)1-2-8(5-23(15,16)17)6-24(18,19)20/h1-6H2,(H2,9,10,11)(H2,12,13,14)(H2,15,16,17)(H2,18,19,20) |
| InChIKey | NFDRPXJGHKJRLJ-UHFFFAOYSA-N |
| SMILES | P(=O)(O)(O)CN(CCN(CP(=O)(O)O)CP(=O)(O)O)CP(=O)(O)O |
| LogP | -4.1 |
| CAS DataBase Reference | 1429-50-1(CAS DataBase Reference) |
| EPA Substance Registry System | Ethylenediamine tetrakis(methylene phosphonic acid) (1429-50-1) |
Description and Uses
Ethylenediaminetetra(methylenephosphonic acid) is a nitrogenous polyphosphonic acid chelator is able to form complexes with various metal ions.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| HS Code | 29212900 |



![N-(2-Aminoethyl)-5-((3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl)pentanamidehydrochloride](https://img.chemicalbook.com/CAS/GIF/111822-45-8.gif)


