A4009912
Ethylenediaminetetraacetic Dianhydride , ≥98.0% , 23911-25-3
Synonym(s):
4,4′-Ethylenebis(2,6-morpholinedione);EDTA dianhydride
| Pack Size | Price | Stock | Quantity |
| 1g | RMB32.80 | In Stock |
|
| 5G | RMB123.20 | In Stock |
|
| 25G | RMB383.20 | In Stock |
|
| 100G | RMB1163.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 190 °C (dec.) (lit.) |
| Boiling point: | 489.5±45.0 °C(Predicted) |
| Density | 1.449 |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | DMSO, Methanol |
| pka | 2.06±0.20(Predicted) |
| form | Solid |
| color | Pale Beige |
| InChI | InChI=1S/C10H12N2O6/c13-7-3-11(4-8(14)17-7)1-2-12-5-9(15)18-10(16)6-12/h1-6H2 |
| InChIKey | POLIXZIAIMAECK-UHFFFAOYSA-N |
| SMILES | C(N1CC(=O)OC(=O)C1)CN1CC(=O)OC(=O)C1 |
Description and Uses
Ethylenediaminetetraacetic Acid Dianhydride (A-EDTA) is used as a reagent in the synthesis of a new class of polymer, poly-2.6-piperazinedione. A-EDTA is also used in the synthesis of EDTA functionalized polyacrylnitriles (PANs) by direct reaction with amine and hydroxyl functionalized polyacrylnitrile.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 29349990 |



