A3987812
Ethylenediaminetetraacetic acid monosodium ferric salt , Powder, 13.0-18.7%Febasis , 15708-41-5
Synonym(s):
Ferric sodium EDTA;Komplexon II;Edathamil;EDTA iron(III) sodium salt;Ethylenediaminetetraacetic acid iron(III) sodium salt
CAS NO.:15708-41-5
Empirical Formula: C10H12FeN2NaO8
Molecular Weight: 367.05
MDL number: MFCD00798117
EINECS: 239-802-2
| Pack Size | Price | Stock | Quantity |
| 100G | RMB31.20 | In Stock |
|
| 250g | RMB55.20 | In Stock |
|
| 500G | RMB70.40 | In Stock |
|
| 2.5KG | RMB319.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 80 °C |
| Density | 1.781[at 20℃] |
| storage temp. | room temp |
| solubility | Methanol (Slightly), Water (Slightly) |
| form | powder |
| color | Yellow-brown |
| PH | 4.5 |
| biological source | synthetic (organic) |
| Water Solubility | soluble |
| Merck | 14,4031 |
| Exposure limits | ACGIH: TWA 1 mg/m3 NIOSH: TWA 1 mg/m3 |
| InChI | InChI=1S/C10H16N2O8.Fe.Na/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;/q;+3;+1/p-4 |
| InChIKey | MKWYFZFMAMBPQK-UHFFFAOYSA-J |
| SMILES | O=C1CN23CCN45CC(=O)[O-][Fe+3]24([O-]C(=O)C5)([O-]C(=O)C3)[O-]1.[Na+] |
| LogP | -8.841 |
| CAS DataBase Reference | 15708-41-5(CAS DataBase Reference) |
| EPA Substance Registry System | Ferrate(1-), [[N,N'-1,2-ethanediylbis[N-[(carboxy-.kappa.O)methyl]glycinato-.kappa.N,.kappa.O]](4-)]-, sodium (1:1), (OC-6-21)- (15708-41-5) |
Description and Uses
Sodium Iron EDTA is often used in children nutrition as a source of iron.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H312-H315-H319-H411 |
| Precautionary statements | P501-P273-P264-P280-P391-P337+P313-P305+P351+P338-P362+P364-P332+P313-P302+P352+P312 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39-36/37 |
| WGK Germany | 2 |
| RTECS | AH4900000 |
| TSCA | Yes |
| HS Code | 29224999 |




