A3996412
Ethyl 2-chloronicotinate , 98% , 1452-94-4
Synonym(s):
Ethyl 2-chloronicotinate;Ethyl 2-chloropyridine-3-carboxylate
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB53.60 | In Stock |
|
| 100G | RMB144.80 | In Stock |
|
| 250g | RMB303.20 | In Stock |
|
| 500g | RMB569.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 68 C |
| Boiling point: | 78°C (0.1 mmHg) |
| Density | 1.2445 g/cm3(Temp: 25 °C) |
| refractive index | 1.5210-1.5250 |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | -1.32±0.10(Predicted) |
| form | Liquid |
| color | Colorless to Light yellow to Light orange |
| Major Application | pharmaceutical |
| InChI | InChI=1S/C8H8ClNO2/c1-2-12-8(11)6-4-3-5-10-7(6)9/h3-5H,2H2,1H3 |
| InChIKey | PMIMPBYTPPRBGD-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=CC=C1C(OCC)=O |
| CAS DataBase Reference | 1452-94-4(CAS DataBase Reference) |
Description and Uses
Ethyl 2-chloronicotinate,is used as a pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-60-37 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 |






