A3996812
Ethyl pentafluoropropionate , 98% , 426-65-3
CAS NO.:426-65-3
Empirical Formula: C5H5F5O2
Molecular Weight: 192.08
MDL number: MFCD00000431
EINECS: 207-043-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB35.20 | In Stock |
|
| 25G | RMB107.20 | In Stock |
|
| 100G | RMB329.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 75.5°C |
| Boiling point: | 75-76 °C (lit.) |
| Density | 1.299 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 35 °F |
| storage temp. | Inert atmosphere,2-8°C |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.299 |
| BRN | 1779789 |
| InChI | InChI=1S/C5H5F5O2/c1-2-12-3(11)4(6,7)5(8,9)10/h2H2,1H3 |
| InChIKey | DBOFMRQAMAZKQY-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C(F)(F)C(F)(F)F |
| CAS DataBase Reference | 426-65-3(CAS DataBase Reference) |
| EPA Substance Registry System | Ethyl perfluoropropionate (426-65-3) |
Description and Uses
Ethyl pentafluoropropionate has been used:
- as pentafluoroethyl source in the direct synthesis of pentafluoroethyl copper (CuC2F5)
- in the synthesis of C-6 substituted fluoroalkenyl 2,4-dimethoxypyrimidine derivative
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | F,Xi |
| Risk Statements | 11-36/37/38 |
| Safety Statements | 16-26-33-36 |
| RIDADR | UN 3272 3/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Flammable |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 29159000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |








