A3997712
1-Ethylnaphthalene , 98% , 1127-76-0
CAS NO.:1127-76-0
Empirical Formula: C12H12
Molecular Weight: 156.22
MDL number: MFCD00004049
EINECS: 214-432-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB28.00 | In Stock |
|
| 5G | RMB52.00 | In Stock |
|
| 25G | RMB199.20 | In Stock |
|
| 100g | RMB719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -15--14 °C (lit.) |
| Boiling point: | 258-260 °C (lit.) |
| Density | 1.008 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 111 °C |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| color | Colorless to pale yellow |
| Water Solubility | 10.7mg/L(25 ºC) |
| BRN | 1854417 |
| InChI | InChI=1S/C12H12/c1-2-10-7-5-8-11-6-3-4-9-12(10)11/h3-9H,2H2,1H3 |
| InChIKey | ZMXIYERNXPIYFR-UHFFFAOYSA-N |
| SMILES | C1(CC)=C2C(C=CC=C2)=CC=C1 |
| LogP | 4.400 |
| CAS DataBase Reference | 1127-76-0(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Ethylnaphthalene (1127-76-0) |
Description and Uses
1-Ethylnaphthalene has been employed as guest molecule to investigate:
- effect of binding Tb3+ to sodium taurocholate aggregates containing polyaromatic hydrocarbon guests
- its binding to aggregates of sodium cholate, taurocholate, deoxycholate and deoxytaurocholate
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves |
| Safety Statements | 23-24/25 |
| WGK Germany | 3 |
| RTECS | QJ6950000 |
| HS Code | 2902.90.9000 |
| Storage Class | 10 - Combustible liquids |






![Cyclopenta[d,e,f]phenanthrene](https://img.chemicalbook.com/CAS/20180808/GIF/203-64-5.gif)
