A1430312
5-Bromoacenaphthene , ≥93.0%(GC) , 2051-98-1
CAS NO.:2051-98-1
Empirical Formula: C12H9Br
Molecular Weight: 233.1
MDL number: MFCD00003809
EINECS: 218-138-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB44.00 | In Stock |
|
| 5G | RMB80.00 | In Stock |
|
| 25G | RMB257.60 | In Stock |
|
| 100G | RMB756.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 54-56 °C(lit.) |
| Boiling point: | 335 °C(lit.) |
| Density | 1.4095 (rough estimate) |
| refractive index | 1.6565 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Refrigerator |
| solubility | Chloroform, Methanol (Slightly) |
| form | Solid |
| color | Light Yellow |
| InChI | InChI=1S/C12H9Br/c13-11-7-6-9-5-4-8-2-1-3-10(11)12(8)9/h1-3,6-7H,4-5H2 |
| InChIKey | QALKJGMGKYKMKE-UHFFFAOYSA-N |
| SMILES | C1C2C3C(C=CC=2)=C(Br)C=CC=3C1 |
| CAS DataBase Reference | 2051-98-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Acenaphthylene, 5-bromo-1,2-dihydro-(2051-98-1) |
Description and Uses
5-Bromoacenaphthene serves as a precursor for synthesizing 5,6-dibromoacenaphthene and 5-bromo-6-chloroacenaphthene. It undergoes ring bromination with hypobromous acid in dioxane to yield 5,6-dibromoacenaphthene, or reacts with bromine to form 3,5- and 3,6-dibromo isomers. The compound also participates in further substitution reactions, including acylation and nitration[1].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29039990 |
| Storage Class | 11 - Combustible Solids |






