PRODUCT Properties
| Boiling point: | 94-96°C/4mm |
| Density | 1.572±0.06 g/cm3(Predicted) |
| refractive index | 1.5600 to 1.5640 |
| Flash point: | 94-96°C/4mm |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Light orange to Yellow to Green |
| Water Solubility | Slightly soluble in water |
| λmax | 277nm(Hexane)(lit.) |
| InChI | InChI=1S/C7H7BrO2S/c1-2-10-7(9)5-3-4-6(8)11-5/h3-4H,2H2,1H3 |
| InChIKey | PZNHMXAOMDQLLE-UHFFFAOYSA-N |
| SMILES | C1(C(OCC)=O)SC(Br)=CC=1 |
Description and Uses
Ethyl 5-bromothiophene-2-carboxylate is used as an intermediate in organic syntheses
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| HS Code | 29349990 |
