A3999912
Ethyl 4-Chloro-2-(methylthio)pyrimidine-5-carboxylate , 98% , 5909-24-0
CAS NO.：5909-24-0
Empirical Formula: C8H9ClN2O2S
Molecular Weight: 232.69
MDL number: MFCD00006085
EINECS: 227-619-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB28.80 | In Stock |
|
| 25G | RMB56.80 | In Stock |
|
| 100G | RMB219.20 | In Stock |
|
| 500g | RMB1023.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 60-63 °C (lit.) |
| Boiling point: | 132°C/0.4mmHg(lit.) |
| Density | 1.37±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform, Ethyl Acetate |
| form | Crystalline Powder |
| pka | -2.19±0.29(Predicted) |
| color | White to light yellow to beige |
| InChI | InChI=1S/C8H9ClN2O2S/c1-3-13-7(12)5-4-10-8(14-2)11-6(5)9/h4H,3H2,1-2H3 |
| InChIKey | SNNHLSHDDGJVDM-UHFFFAOYSA-N |
| SMILES | C1(SC)=NC=C(C(OCC)=O)C(Cl)=N1 |
| CAS DataBase Reference | 5909-24-0(CAS DataBase Reference) |
Description and Uses
Ethyl 4-chloro-2-methylthio-5-pyrimidinecarboxylate was used in the synthesis of pyrimidinopyridones, potential inhibitors of the FMS tyrosine kinase.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT, KEEP COLD |
| HS Code | 29339900 |
