A4000512
Ethyl (3-fluorobenzoyl)acetate , 98% , 33166-77-7
Synonym(s):
(m-Fluorobenzoyl)acetic acid ethyl ester;3-(3-Fluorophenyl)-3-oxopropanoic acid ethyl ester;3-(3-Fluorophenyl)-3-oxo-propionic acid ethyl ester;Ethyl m-fluorobenzoyl acetate;Ethyl 2-3-fluorobenzoylacetate
| Pack Size | Price | Stock | Quantity |
| 1G | RMB239.76 | In Stock |
|
| 5G | RMB891.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 262-263 °C(lit.) |
| Density | 1.166 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| pka | 10.10±0.46(Predicted) |
| color | Colorless to orange |
| InChI | 1S/C11H11FO3/c1-2-15-11(14)7-10(13)8-4-3-5-9(12)6-8/h3-6H,2,7H2,1H3 |
| InChIKey | MLABEWHVTXMKHP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)c1cccc(F)c1 |
| CAS DataBase Reference | 33166-77-7(CAS DataBase Reference) |
Description and Uses
Reactant for:
- Preparation of biologically active molecules
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| PPE | Eyeshields, Gloves |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 2916399090 |
| Storage Class | 10 - Combustible liquids |







