PRODUCT Properties
| Boiling point: | 193 °C |
| Density | 1,01 g/cm3 |
| refractive index | 1.4130-1.4150 |
| Flash point: | 96°C |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| color | Colorless to Light yellow |
| InChI | InChI=1S/C6H9NO2/c1-3-9-6(8)5(2)4-7/h5H,3H2,1-2H3 |
| InChIKey | MIHRVXYXORIINI-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C(C#N)C |
| CAS DataBase Reference | 1572-99-2 |
Description and Uses
Ethyl 2-Cyanopropanoate is a building block used in many organic reactions such as the preparation of highly substituted benzenes.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS07 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319 |
| Precautionary statements | P264-P270-P280-P301+P310+P330-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P405-P501 |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 23-36/37/39 |
| RIDADR | 3276 |
| HazardClass | 6.1 |
| PackingGroup | Ⅲ |
| HS Code | 29159000 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







