PRODUCT Properties
| Boiling point: | 435.2±45.0 °C(Predicted) |
| Density | 1.86±0.1 g/cm3(Predicted) |
| vapor pressure | 2 x 10-7 mmHg at 25 °C (Martin, 1972) |
| Flash point: | 11 °C |
| storage temp. | 0-6°C |
| Water Solubility | 260 μg/L at 25 °C (extraction-GLC, Weil et al., 1974) |
| Henry's Law Constant | 3.86(x 10-7 atm?m3/mol) at 25 °C (approximate - calculated from water solubility and vapor pressure) |
| Major Application | agriculture |
| InChI | 1S/C12H8Cl6O/c13-8-5-3(2-19)1-4-6(5)9(14,12(8,17)18)11(16)7(4)10(8,11)15/h2-7H,1H2 |
| InChIKey | HCTWZIFNBBCVGM-UHFFFAOYSA-N |
| SMILES | ClC21C3(C2C4C5C1(C(C3(C5C(C4)C=O)Cl)(Cl)Cl)Cl)Cl |
| EPA Substance Registry System | Endrin aldehyde (7421-93-4) |
Description and Uses
Endrin aldehyde
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H413 |
| Precautionary statements | P273-P301+P312+P330 |
| Hazard Codes | Xn,T,F |
| Risk Statements | 22-39/23/24/25-23/24/25-11 |
| Safety Statements | 7-16-36/37-45 |
| RIDADR | 2761 |
| WGK Germany | 3 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Hazardous Substances Data | 7421-93-4(Hazardous Substances Data) |






