A4010312
Econazole nitrate , ≥98%(HPLC) , 24169-02-6
Synonym(s):
1-(2-[(4-Chlorophenyl)methoxy]-2-[2,4-dichlorophenyl]ethyl)-1H-imidazole;1-[2-[(4-Chlorophenyl)methoxy]-2-(2,4-dichlorophenyl)ethyl]-1H-imidazole mononitrate;1-{2,4-Dichloro-β-[(p-chlorobenzyl)oxy}phenethyl]imidazole mononitrate
CAS NO.:24169-02-6
Empirical Formula: C18H16Cl3N3O4
Molecular Weight: 444.7
MDL number: MFCD00058160
EINECS: 246-053-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB42.40 | In Stock |
|
| 25G | RMB100.80 | In Stock |
|
| 100G | RMB367.20 | In Stock |
|
| 500G | RMB1679.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 162°C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | chloroform/methanol: soluble25mg/mL (choloroform:methanol (1:1)) |
| form | powder |
| color | white to off-white |
| Water Solubility | <0.1 g/100 mL at 19 ºC |
| Merck | 14,3502 |
| InChI | InChI=1S/C18H15Cl3N2O.HNO3/c19-14-3-1-13(2-4-14)11-24-18(10-23-8-7-22-12-23)16-6-5-15(20)9-17(16)21;2-1(3)4/h1-9,12,18H,10-11H2;(H,2,3,4) |
| InChIKey | DDXORDQKGIZAME-UHFFFAOYSA-N |
| SMILES | C1(C(Cl)=CC(Cl)=CC=1)C(OCC1=CC=C(Cl)C=C1)CN1C=NC=C1.[N+]([O-])(=O)O |
| CAS DataBase Reference | 24169-02-6(CAS DataBase Reference) |
| EPA Substance Registry System | Econazole mononitrate (24169-02-6) |
Description and Uses
Azole antifungal
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/38-36/37/38 |
| Safety Statements | 26-36-36/37 |
| WGK Germany | 3 |
| RTECS | NI4450000 |
| HS Code | 29332900 |
| Toxicity | LD50 in mice, rats (mg/kg): 462.7, 667.7 orally (Thienpont) |





