(±)-Miconazole nitrate salt , 98% , 22832-87-7
Synonym(s):
(±)-Miconazole nitrate salt;1-(2,4-Dichloro-β-[(2,4-dichlorobenzyl)oxy]phenethyl)imidazole
CAS NO.:22832-87-7
Empirical Formula: C18H15Cl4N3O4
Molecular Weight: 479.14
MDL number: MFCD00058161
EINECS: 245-256-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB41.60 | In Stock |
|
| 5G | RMB102.40 | In Stock |
|
| 25G | RMB295.20 | In Stock |
|
| 100g | RMB767.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 170-185 C |
| Density | 1.5000 (rough estimate) |
| refractive index | 1.6200 (estimate) |
| storage temp. | 2-8°C |
| solubility | pyridine: soluble50mg/mL |
| form | Solid |
| color | white to off-white |
| optical activity | [α]25/D 0°, c = 10 in water |
| Water Solubility | Slightly soluble in water. Soluble in propylene glycol or pyridine. |
| Merck | 14,6178 |
| Major Application | pharmaceutical (small molecule) |
| Cosmetics Ingredients Functions | ANTIMICROBIAL |
| InChI | InChI=1S/C18H14Cl4N2O.HNO3/c19-13-2-1-12(16(21)7-13)10-25-18(9-24-6-5-23-11-24)15-4-3-14(20)8-17(15)22;2-1(3)4/h1-8,11,18H,9-10H2;(H,2,3,4) |
| InChIKey | MCCACAIVAXEFAL-UHFFFAOYSA-N |
| SMILES | C(C1C=CC(=CC=1Cl)Cl)(OCC1C=CC(=CC=1Cl)Cl)CN1C=NC=C1.N(O)(=O)=O |
| CAS DataBase Reference | 22832-87-7(CAS DataBase Reference) |
Description and Uses
Miconazole is a widely used antifungal imidazole that acts by inhibiting the 14α-
Miconazole is a widely used antifungal imidazole that acts by inhibiting the 14α-demethylation of lanosterol, which consequently leads to the inhibition of ergosterol synthesis in fungal cell membranes. Additionally, miconazole has been shown to induce reactive oxygen species in fungal biofilms, demonstrating a MIC value of ≥256 μM against Candida spp.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H317 |
| Precautionary statements | P280-P301+P312+P330 |
| Hazard Codes | Xn |
| Risk Statements | 22-43-40 |
| Safety Statements | 36/37 |
| RIDADR | 3249 |
| WGK Germany | 3 |
| RTECS | NI4771000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 2933290000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Skin Sens. 1 |







