A7376912
Sulconazole Nitrate , ≥95% , 61318-91-0
CAS NO.:61318-91-0
Empirical Formula: C18H16Cl3N3O3S
Molecular Weight: 460.76
MDL number: MFCD00058163
EINECS: 624-696-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB79.20 | In Stock |
|
| 1G | RMB231.20 | In Stock |
|
| 5G | RMB509.60 | In Stock |
|
| 25G | RMB998.40 | In Stock |
|
| 100G | RMB1696.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 130.5-132℃ |
| storage temp. | room temp |
| solubility | DMF: 25 mg/ml; DMSO: 25 mg/ml; DMSO:PBS (pH 7.2) (1:2): 0.33 mg/ml; Ethanol: 0.1 mg/ml |
| form | powder to crystal |
| color | white |
| InChI | InChI=1S/C18H15Cl3N2S.HNO3/c19-14-3-1-13(2-4-14)11-24-18(10-23-8-7-22-12-23)16-6-5-15(20)9-17(16)21;2-1(3)4/h1-9,12,18H,10-11H2;(H,2,3,4) |
| InChIKey | CRKGMGQUHDNAPB-UHFFFAOYSA-N |
| SMILES | C1(C(Cl)=CC(Cl)=CC=1)C(SCC1=CC=C(Cl)C=C1)CN1C=NC=C1.[N+]([O-])(=O)O |
| CAS DataBase Reference | 61318-91-0 |
Description and Uses
H2 antihistamine







