A4014512
N-[(S)-(+)-1-(Ethoxycarbonyl)-3-phenylpropyl]-L-alanine , >98.0%(HPLC) , 82717-96-2
Synonym(s):
N-[(S)-(+)-1-(Ethoxycarbonyl)-3-phenylpropyl]-L -alanine;Enalapril Impurity B (Ph. Eur);Quinapril Impurity B (Ph. Eur);Ramipril Impurity F (Ph. Eur.);Spirapril Impurity C (Ph. Eur.)
CAS NO.:82717-96-2
Empirical Formula: C15H21NO4
Molecular Weight: 279.34
MDL number: MFCD00209976
EINECS: 1308068-626-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5G | RMB31.20 | In Stock |
|
| 25G | RMB74.40 | In Stock |
|
| 100g | RMB238.40 | In Stock |
|
| 500g | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 150-152 °C(lit.) |
| Boiling point: | 422.1°C (rough estimate) |
| alpha | +28° (20℃/D)(c=1, CH3OH) |
| Density | 1.1083 (rough estimate) |
| vapor pressure | 1.95hPa at 25℃ |
| refractive index | 29.5 ° (C=1, MeOH) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | 6g/l |
| pka | 2.14±0.10(Predicted) |
| form | Crystalline Powder |
| color | White |
| optical activity | [α]20/D +28°, c = 1 in methanol |
| Water Solubility | 100mg/L at 25℃ |
| BRN | 3619501 |
| Major Application | peptide synthesis |
| InChI | 1S/C15H21NO4/c1-3-20-15(19)13(16-11(2)14(17)18)10-9-12-7-5-4-6-8-12/h4-8,11,13,16H,3,9-10H2,1-2H3,(H,17,18)/t11-,13-/m0/s1 |
| InChIKey | CEIWXEQZZZHLDM-AAEUAGOBSA-N |
| SMILES | CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(O)=O |
| LogP | 0.12 at 25℃ |
| CAS DataBase Reference | 82717-96-2(CAS DataBase Reference) |
Description and Uses
Moexipril intermediate; the main metabolite of Imidapril.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-36 |
| WGK Germany | 3 |
| HS Code | 29224999 |
| Storage Class | 11 - Combustible Solids |

![N-[(S)-(+)-1-(Ethoxycarbonyl)-3-phenylpropyl]-L-alanine](https://img.chemicalbook.com/CAS/GIF/82717-96-2.gif)



