PRODUCT Properties
| Melting point: | 37-39°C |
| Boiling point: | 70°C 0,8mm |
| Density | 1.139±0.06 g/cm3(Predicted) |
| Flash point: | 70°C/0.8mm |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 15.25±0.50(Predicted) |
| color | White to Yellow to Orange |
| BRN | 2645 |
| InChI | InChI=1S/C7H9NO2/c1-2-10-7(9)6-4-3-5-8-6/h3-5,8H,2H2,1H3 |
| InChIKey | PAEYAKGINDQUCT-UHFFFAOYSA-N |
| SMILES | N1C=CC=C1C(OCC)=O |
| LogP | 1.730 (est) |
| CAS DataBase Reference | 2199-43-1(CAS DataBase Reference) |
Description and Uses
Ethyl pyrrole-2-carboxylate is a pyrole derivative used in the preparation of heterocyclic bioactive agents and other pharmaceutical compounds. A catalyst in olefin polymerization.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 41 |
| Safety Statements | 24/25 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







