A6665712
Pyrrole-2-carboxylic acid , 98% , 634-97-9
CAS NO.:634-97-9
Empirical Formula: C5H5NO2
Molecular Weight: 111.1
MDL number: MFCD00005219
EINECS: 211-221-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB43.20 | In Stock |
|
| 25G | RMB183.20 | In Stock |
|
| 100g | RMB655.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 204-208 °C (dec.) (lit.) |
| Boiling point: | 340.3±15.0 °C(Predicted) |
| Density | 0.862 |
| refractive index | 1.441-1.445 |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in methanol. |
| form | Powder |
| pka | 4.45(at 20℃) |
| color | White to off-white to pale pink |
| BRN | 80825 |
| InChI | InChI=1S/C5H5NO2/c7-5(8)4-2-1-3-6-4/h1-3,6H,(H,7,8) |
| InChIKey | WRHZVMBBRYBTKZ-UHFFFAOYSA-N |
| SMILES | N1C=CC=C1C(O)=O |
| CAS DataBase Reference | 634-97-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Pyrrole-2-carboxylic acid(634-97-9) |
Description and Uses
Pyrrole-2-carboxylic Acid is a reagent used in the synthesis of potent small molecule inhibitors of severe acute respiratory syndrome (SARS) coronavirus. Also used in the synthesis of [2,3-c]pyridine-7-one scaffolds.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







