A4018412
Ethyl acetimidate hydrochloride , 97% , 2208-07-3
CAS NO.:2208-07-3
Empirical Formula: C4H10ClNO
Molecular Weight: 123.58
MDL number: MFCD00012572
EINECS: 218-631-7
| Pack Size | Price | Stock | Quantity |
| 5g | RMB29.60 | In Stock |
|
| 10G | RMB66.40 | In Stock |
|
| 50G | RMB230.40 | In Stock |
|
| 250G | RMB839.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 112-114 °C(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | water: soluble50mg/mL, clear, colorless |
| form | Crystalline Powder |
| color | White |
| Water Solubility | Soluble in water (50mg/L). |
| Sensitive | Moisture Sensitive |
| BRN | 3552401 |
| Stability: | Hygroscopic, Moisture Sensitive |
| InChI | InChI=1S/C4H9NO.ClH/c1-3-6-4(2)5;/h5H,3H2,1-2H3;1H |
| InChIKey | WGMHMVLZFAJNOT-UHFFFAOYSA-N |
| SMILES | O(CC)C(=N)C.Cl |
| CAS DataBase Reference | 2208-07-3(CAS DataBase Reference) |
| EPA Substance Registry System | Ethanimidic acid, ethyl ester, hydrochloride (2208-07-3) |
Description and Uses
Ethyl acetimidate hydrochloride was used in preparation of amidinated carbonic anhydrase via chemical modification of human erythrocyte carbonic anhydrase. It was also used in synthesis of methyl 2-methyl-2-thiazoline-4-carboxylate hydrochloride.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| F | 3-10-21 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29252900 |
| Storage Class | 11 - Combustible Solids |







