PRODUCT Properties
| Boiling point: | 94-95 °C1 mm Hg(lit.) |
| Density | 1.129 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | liquid |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C8H11O2P/c1-2-10-11(9)8-6-4-3-5-7-8/h3-7,11H,2H2,1H3 |
| InChIKey | UNUJZVUJPIOMGH-UHFFFAOYSA-N |
| SMILES | P(C1=CC=CC=C1)(OCC)=O |
Description and Uses
Ethyl phenylphosphinate may be used in the preparation of the following diethyl imidazol-2-yl-(amino) methylphosphonates and phosphinates:
- imidazol-2-yl-methyl(N-butylamino)phosphonate diethyl ester
- imidazol-2-yl-methyl(N-benzylamino)phosphonate diethyl ester
- imidazol-2-yl-methyl(N-butylamino)phenylphosphinate ethyl ester
- imidazol-2-yl-methyl(N-benzylamino)phenylphosphinate ethyl ester
Safety
| Symbol(GHS) | ![]() GHS07 |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P233-P260-P261-P264-P271-P280-P302+P352-P304-P304+P340-P305+P351+P338-P312-P321-P332+P313-P337+P313-P340-P362-P403-P403+P233-P405-P501 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | 3 |
| RTECS | SZ5600000 |






