A4205812
Ethyl (2,4,6-trimethylbenzoyl) phenylphosphinate , 98% , 84434-11-7
CAS NO.:84434-11-7
Empirical Formula: C18H21O3P
Molecular Weight: 316.33
MDL number: MFCD08692488
EINECS: 282-810-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5g | RMB29.60 | In Stock |
|
| 10g | RMB38.40 | In Stock |
|
| 25G | RMB63.20 | In Stock |
|
| 100G | RMB186.40 | In Stock |
|
| 500g | RMB635.20 | In Stock |
|
| 2.5kg | RMB2559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 144.5-147 °C(lit.) |
| Boiling point: | 456.0±55.0 °C(Predicted) |
| Density | 1.14 |
| vapor pressure | 0Pa at 20℃ |
| refractive index | 1.5610 |
| Flash point: | 184° |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | 71.8g/L in organic solvents at 20 ℃ |
| form | Oil to Thick Oil |
| color | Colourless to Yellow |
| Water Solubility | 35mg/L at 25℃ |
| Cosmetics Ingredients Functions | UV ABSORBER |
| InChI | InChI=1S/C18H21O3P/c1-5-21-22(20,16-9-7-6-8-10-16)18(19)17-14(3)11-13(2)12-15(17)4/h6-12H,5H2,1-4H3 |
| InChIKey | ZMDDERVSCYEKPQ-UHFFFAOYSA-N |
| SMILES | P(C1=CC=CC=C1)(C(=O)C1=C(C)C=C(C)C=C1C)(OCC)=O |
| LogP | 2.91 at 25℃ |
| CAS DataBase Reference | 84434-11-7(CAS DataBase Reference) |
Description and Uses
P-Phenyl-P-(2,4,6-trimethylbenzoyl)-Phosphinic acid Ethyl Ester is a photoinitiator for UV curable coatings.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36 |
| Safety Statements | 26 |
| WGK Germany | 2 |
| RTECS | DJ0700000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Chronic 2 Skin Sens. 1B |







