A3477812
2,2-Diethoxyacetophenone , >95.0%(GC) , 6175-45-7
Synonym(s):
α,α-Diethoxyacetophenone;Phenylglyoxal 2-diethyl acetal
CAS NO.:6175-45-7
Empirical Formula: C12H16O3
Molecular Weight: 208.25
MDL number: MFCD00009659
EINECS: 228-220-4
| Pack Size | Price | Stock | Quantity |
| 25G | RMB39.20 | In Stock |
|
| 100G | RMB156.80 | In Stock |
|
| 500G | RMB559.20 | In Stock |
|
| 2.5kg | RMB2239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 131-134 °C/10 mmHg (lit.) |
| Density | 1.034 g/mL at 25 °C (lit.) |
| vapor pressure | 0.01 mm Hg ( 20 °C) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,2-8°C |
| form | Liquid |
| color | Clear yellow |
| Specific Gravity | 1.034 |
| Water Solubility | 0.16 g/L (25 ºC) |
| BRN | 2100306 |
| InChI | InChI=1S/C12H16O3/c1-3-14-12(15-4-2)11(13)10-8-6-5-7-9-10/h5-9,12H,3-4H2,1-2H3 |
| InChIKey | PIZHFBODNLEQBL-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=CC=C1)C(OCC)OCC |
| CAS DataBase Reference | 6175-45-7(CAS DataBase Reference) |
| EPA Substance Registry System | Ethanone, 2,2-diethoxy-1-phenyl- (6175-45-7) |
Description and Uses
It is an effective photoinitiator for UV-curable acrylate-based coatings, adhesives and inks. used in UV-curable system. Particularly useful for photo curing clear acrylate-based formulations where non-yellowing is important. It is also recommended for pigmented inks where shelf life and color stability are essential.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-33-40 |
| Safety Statements | 23-24/25-36 |
| WGK Germany | 3 |
| RTECS | MD3284000 |
| TSCA | TSCA listed |
| HS Code | 29145090 |
| Storage Class | 10 - Combustible liquids |







