A1469312
2-Benzyl-2-(dimethylamino)-4′-morpholinobutyrophenone , ≥98.0%(HPLC) , 119313-12-1
Synonym(s):
2-(Dimethylamino)-1-(4-morpholinophenyl)-2-benzyl-1-butanone;2-(Dimethylamino)-1-[4-(4-morpholinyl)phenyl]-2-(phenylmethyl)-1-butanone;2-Benzyl-2-dimethylamino-1-(4-morpholinophehyl)-butane-1-one
CAS NO.：119313-12-1
Empirical Formula: C23H30N2O2
Molecular Weight: 366.5
MDL number: MFCD00191775
EINECS: 404-360-3
| Pack Size | Price | Stock | Quantity |
| 5g | RMB23.20 | In Stock |
|
| 25G | RMB79.20 | In Stock |
|
| 100G | RMB221.60 | In Stock |
|
| 500g | RMB740.00 | In Stock |
|
| 2.5kg | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 116-119 °C (lit.) |
| Boiling point: | 528.8±50.0 °C(Predicted) |
| Density | 1.094±0.06 g/cm3(Predicted) |
| vapor pressure | 0-0.01Pa at 25-95℃ |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | 3240 in mg/100g standard fat at 20 ℃ |
| form | powder to crystal |
| pka | 7.04±0.50(Predicted) |
| color | Light orange to Yellow to Green |
| Water Solubility | 5.9mg/L at 20℃ |
| Cosmetics Ingredients Functions | BINDING |
| InChI | 1S/C23H30N2O2/c1-4-23(24(2)3,18-19-8-6-5-7-9-19)22(26)20-10-12-21(13-11-20)25-14-16-27-17-15-25/h5-13H,4,14-18H2,1-3H3 |
| InChIKey | UHFFVFAKEGKNAQ-UHFFFAOYSA-N |
| SMILES | CCC(Cc1ccccc1)(N(C)C)C(=O)c2ccc(cc2)N3CCOCC3 |
| LogP | 2.91 at 25℃ |
| CAS DataBase Reference | 119313-12-1(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Butanone, 2-(dimethylamino)-1-[4-(4-morpholinyl)phenyl]-2-(phenylmethyl)- (119313-12-1) |
Description and Uses
UV solidify ink and coating
Safety
| Symbol(GHS) |   GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H360D-H410 |
| Precautionary statements | P201-P202-P273-P280-P308+P313-P391 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| RTECS | EL7755000 |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29349990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Repr. 1B |
