A2253812
4-Chlorobenzophenone , 99% , 134-85-0
Synonym(s):
(4-Chlorophenyl)phenylmethanone
CAS NO.:134-85-0
Empirical Formula: C13H9ClO
Molecular Weight: 216.66
MDL number: MFCD00000622
EINECS: 205-160-7
| Pack Size | Price | Stock | Quantity |
| 25G | RMB24.00 | In Stock |
|
| 100G | RMB44.80 | In Stock |
|
| 500G | RMB136.00 | In Stock |
|
| 2.5KG | RMB479.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 74-76 °C (lit.) |
| Boiling point: | 195-196 °C/17 mmHg (lit.) |
| Density | 1.1459 (rough estimate) |
| vapor pressure | 0.015Pa at 25℃ |
| refractive index | 1.5260 (estimate) |
| Flash point: | 143°C |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Powder |
| color | White to off-white |
| Water Solubility | 20.706mg/L at 29℃ |
| BRN | 512043 |
| InChI | 1S/C13H9ClO/c14-12-8-6-11(7-9-12)13(15)10-4-2-1-3-5-10/h1-9H |
| InChIKey | UGVRJVHOJNYEHR-UHFFFAOYSA-N |
| SMILES | Clc1ccc(cc1)C(=O)c2ccccc2 |
| LogP | 3.748 at 25℃ |
| CAS DataBase Reference | 134-85-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Methanone, (4-chlorophenyl)phenyl-(134-85-0) |
| EPA Substance Registry System | Methanone, (4-chlorophenyl)phenyl- (134-85-0) |
Description and Uses
UV curing type coating, printing ink, medical and pesticide intermediate
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 2 |
| RTECS | AM5978800 |
| F | 19 |
| TSCA | TSCA listed |
| HS Code | 29147000 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 134-85-0(Hazardous Substances Data) |







