A4020712
Ethyl (S)-(+)-2-pyrrolidone-5-carboxylate , 98% , 7149-65-7
Synonym(s):
(S)-5-Oxoproline ethyl ester;L -Pyroglutamic acid ethyl ester
CAS NO.:7149-65-7
Empirical Formula: C7H11NO3
Molecular Weight: 157.17
MDL number: MFCD00064497
EINECS: 230-480-9
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB25.60 | In Stock |
|
| 25G | RMB39.20 | In Stock |
|
| 100g | RMB127.20 | In Stock |
|
| 500g | RMB617.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 54-56 °C |
| Boiling point: | 176 °C12 mm Hg(lit.) |
| alpha | -3.5 º (c=5, water) |
| Density | 1.2483 (rough estimate) |
| refractive index | 1.4310 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 14.78±0.40(Predicted) |
| form | Low Melting Solid |
| color | White to cream |
| optical activity | [α]19/D +3.3°, c = 10 in ethanol |
| BRN | 82621 |
| Major Application | peptide synthesis |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChI | InChI=1S/C7H11NO3/c1-2-11-7(10)5-3-4-6(9)8-5/h5H,2-4H2,1H3,(H,8,9)/t5-/m0/s1 |
| InChIKey | QYJOOVQLTTVTJY-YFKPBYRVSA-N |
| SMILES | C(OCC)(=O)[C@@H]1CCC(=O)N1 |
| LogP | -1.390 (est) |
| CAS DataBase Reference | 7149-65-7(CAS DataBase Reference) |
Description and Uses
(S)-(+)-5-Ethylcarboxyl-2-pyrrolidinone (cas# 7149-65-7) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| F | 3-10 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




