A4022612
2-ethylhexyl chloroformate , ≥95.0% , 24468-13-1
CAS NO.:24468-13-1
Empirical Formula: C9H17ClO2
Molecular Weight: 192.68
MDL number: MFCD00000643
EINECS: 246-278-9
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 106-107 °C30 mm Hg(lit.) |
| Density | 0.981 g/mL at 25 °C(lit.) |
| vapor density | >1 (vs air) |
| vapor pressure | 0.1 psi ( 20 °C) |
| refractive index | n |
| Flash point: | 179 °F |
| storage temp. | 2-8°C |
| solubility | Ether,Benzene,Chloroform[soluble in] |
| solubility | soluble in Ether,Benzene,Chloroform |
| form | clear liquid |
| color | Colorless to Light yellow |
| InChI | InChI=1S/C9H17ClO2/c1-3-5-6-8(4-2)7-12-9(10)11/h8H,3-7H2,1-2H3 |
| InChIKey | RTGLJCSUKOLTEM-UHFFFAOYSA-N |
| SMILES | C(Cl)(OCC(CC)CCCC)=O |
| CAS DataBase Reference | 24468-13-1(CAS DataBase Reference) |
| EPA Substance Registry System | Carbonochloridic acid, 2-ethylhexyl ester (24468-13-1) |
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H300+H310+H330-H314-H290-H315-H317-H330 |
| Precautionary statements | P260-P280-P284-P310-P234-P262-P264-P270-P271-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P390-P403+P233-P405-P406-P501 |
| Hazard Codes | T,T+ |
| Risk Statements | 23/24/25-34-43-38-26 |
| Safety Statements | 26-27-36/37/39-45-36/37-28 |
| RIDADR | UN 2748 6.1/PG 2 |
| WGK Germany | 2 |
| RTECS | FG3660000 |
| TSCA | TSCA listed |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| HS Code | 29159000 |
| Limited Quantities | 100ml (liquid) or 0.5 Kg (solid) |
| Excepted Quantities | Max Inner Pack (1g or 1ml) and Max Outer Pack (500g or 500ml) |







