A4714331
Cyclopentyl chloroformate , 90% , 50715-28-1
CAS NO.：50715-28-1
Empirical Formula: C6H9ClO2
Molecular Weight: 148.59
MDL number: MFCD00144029
EINECS: 411-460-0
| Pack Size | Price | Stock | Quantity |
| 5g | RMB51.20 | In Stock |
|
| 25g | RMB149.60 | In Stock |
|
| 100g | RMB435.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 69.0-70.5 °C(Press: 25 Torr) |
| Density | 1.19±0.1 g/cm3(Predicted) |
| form | liquid |
| color | Brown |
| InChI | InChI=1S/C6H9ClO2/c7-6(8)9-5-3-1-2-4-5/h5H,1-4H2 |
| InChIKey | ZFQCRLNKHHXELH-UHFFFAOYSA-N |
| SMILES | C(Cl)(OC1CCCC1)=O |
| CAS DataBase Reference | 50715-28-1(CAS DataBase Reference) |
Description and Uses
Cyclopentyl Chloroformate is a chemical reagent used in the synthesis of novel peptidomimetic Hep C protease inhibitors.
Safety
| Symbol(GHS) |    GHS02,GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H226-H317-H318-H331 |
| Precautionary statements | P210-P280 |
| Hazard Codes | Xi,T |
| Risk Statements | 10-22-23-41-43-48/22 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN3277 |
| Hazard Note | Irritant |
| HazardClass | 6.1, 8 |
| HS Code | 2916200090 |
| Limited Quantities | 100ml (liquid) or 0.5 Kg (solid) |
| Excepted Quantities | Max Inner Pack (1g or 1ml) and Max Outer Pack (500g or 500ml) |
