A4024812
1,4-Dihydro-2-(methylthio)-4-oxo-5-pyrimidinecarboxylic acid ethyl ester , 95% , 53554-29-3
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB184.80 | In Stock |
|
| 25g | RMB628.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 136-144°C |
| Density | 1.37±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 6.48±0.50(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C8H10N2O3S/c1-3-13-7(12)5-4-9-8(14-2)10-6(5)11/h4H,3H2,1-2H3,(H,9,10,11) |
| InChIKey | HDIWKNXVBQPJCO-UHFFFAOYSA-N |
| SMILES | C1(SC)NC(=O)C(C(OCC)=O)=CN=1 |
| CAS DataBase Reference | 53554-29-3(CAS DataBase Reference) |
Description and Uses
1,4-Dihydro-2-methylmercapto-4-oxo-5-pyrimidinecarboxylic acid ethyl ester can be used as several synthetic intermediates and pharmaceutical intermediates, mainly used in laboratory research and development process and pharmaceutical and chemical production process.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| HazardClass | IRRITANT |
| HS Code | 2933599590 |



![ETHYL 2-(METHYLSULFANYL)-4-[3-(TRIFLUOROMETHYL)PHENOXY]-5-PYRIMIDINECARBOXYLATE](https://img.chemicalbook.com/StructureFile/ChemBookStructure5/GIF/CB2716244.gif)


