A4030112
Ethyl 3-Methylpyrazole-4-carboxylate , 95% , 85290-78-4
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB35.20 | In Stock |
|
| 1G | RMB97.60 | In Stock |
|
| 5G | RMB225.60 | In Stock |
|
| 25g | RMB1055.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 49-52°C |
| Boiling point: | 280.6±20.0 °C(Predicted) |
| Density | 1.171±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,2-8°C |
| solubility | soluble in Chloroform, Methanol |
| pka | 12.26±0.50(Predicted) |
| form | solid |
| color | Light yellow to yellow |
| InChI | InChI=1S/C7H10N2O2/c1-3-11-7(10)6-4-8-9-5(6)2/h4H,3H2,1-2H3,(H,8,9) |
| InChIKey | HHYVTIKYZUMDIL-UHFFFAOYSA-N |
| SMILES | N1C=C(C(OCC)=O)C(C)=N1 |
Description and Uses
Shows systemic antifungal activity accompanied by high levels of phytotoxicity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H302+H312+H332-H319 |
| Precautionary statements | P271-P261-P280 |
| WGK Germany | 3 |
| HS Code | 2933119000 |






