A4035312
Ethyl (hydroxyimino)cyanoacetate , 98% , 3849-21-6
Synonym(s):
Ethyl cyano(hydroxyimino)acetate;Ethyl cyanoglyoxalate-2-oxime;Ethyl isonitrosocyanoacetate;Oxyma Pure
CAS NO.:3849-21-6
Empirical Formula: C5H6N2O3
Molecular Weight: 142.11
MDL number: MFCD00002112
EINECS: 223-351-3
| Pack Size | Price | Stock | Quantity |
| 25G | RMB23.20 | In Stock |
|
| 5G | RMB23.20 | In Stock |
|
| 100G | RMB69.60 | In Stock |
|
| 500G | RMB306.40 | In Stock |
|
| 1kg | RMB544.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 130-132 °C (lit.) |
| Boiling point: | 259.65°C (rough estimate) |
| Density | 1.4801 (rough estimate) |
| refractive index | 1.5090 (estimate) |
| storage temp. | Store at +2°C to +8°C. |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 6.18±0.10(Predicted) |
| color | Off-White |
| BRN | 774783 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C5H6N2O3/c1-2-10-5(8)4(3-6)7-9/h9H,2H2,1H3 |
| InChIKey | LCFXLZAXGXOXAP-QPJJXVBHSA-N |
| SMILES | C(OCC)(=O)C(C#N)=NO |
| CAS DataBase Reference | 3849-21-6(CAS DataBase Reference) |
Description and Uses
This product is a non-explosive alternative to HOBt or HOAt, and allows high peptide coupling rates at low racemization when applied in combination with carbodiimides.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Warning |
| Hazard statements | H301 |
| Precautionary statements | P264-P270-P301+P310a-P321-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22 |
| Safety Statements | 22-24/25-36/37 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| F | 10 |
| Hazard Note | Irritant |
| HS Code | 2928 00 90 |
| HazardClass | 6.1 |
| PackingGroup | III |
| Storage Class | 11 - Combustible Solids |







