A4036612
2-Bromovaleric Acid Ethyl Ester , ≥98.0%(GC) , 615-83-8
CAS NO.：615-83-8
Empirical Formula: C7H13BrO2
Molecular Weight: 209.08
MDL number: MFCD00000159
EINECS: 210-450-1
| Pack Size | Price | Stock | Quantity |
| 5g | RMB35.20 | In Stock |
|
| 25G | RMB73.60 | In Stock |
|
| 100G | RMB195.20 | In Stock |
|
| 500G | RMB736.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 190-192 °C(lit.) |
| Density | 1.226 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 171 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Liquid |
| Specific Gravity | 1.22 |
| color | Clear colorless |
| Water Solubility | insoluble |
| BRN | 1098901 |
| InChI | InChI=1S/C7H13BrO2/c1-3-5-6(8)7(9)10-4-2/h6H,3-5H2,1-2H3 |
| InChIKey | ORSIRXYHFPHWTN-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C(Br)CCC |
| CAS DataBase Reference | 615-83-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Ethyl 2-bromovalerate(615-83-8) |
Description and Uses
Ethyl 2-Bromovalerate, is an organic building block used for the synthesis of various pharmaceutical compounds.
Safety
| Symbol(GHS) |   GHS07,GHS05 |
| Signal word | Danger |
| Hazard statements | H227-H290-H314-H335-H318 |
| Precautionary statements | P261-P280-P305+P351+P338-P310-P210-P234-P260-P264-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P390-P403+P235-P405-P406-P501-P210e-P260h-P303+P361+P353-P501a |
| Hazard Codes | C,Xi |
| Risk Statements | 34-36/37-36/37/38 |
| Safety Statements | 23-26-27-36/37/39-45-24/25 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29159080 |
