A4050312
Ethyl 4,6-Dihydroxynicotinate , ≥96.0% , 6975-44-6
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB43.20 | In Stock |
|
| 1G | RMB107.20 | In Stock |
|
| 5G | RMB338.40 | In Stock |
|
| 25g | RMB1220.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 214-217° |
| Boiling point: | 339.4±42.0 °C(Predicted) |
| Density | 1.380 |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | 4.50±1.00(Predicted) |
| color | White to Orange to Green |
| InChI | InChI=1S/C8H9NO4/c1-2-13-8(12)5-4-9-7(11)3-6(5)10/h3-4H,2H2,1H3,(H2,9,10,11) |
| InChIKey | QDHHLXABEXNRJX-UHFFFAOYSA-N |
| SMILES | C1NC(=O)C=C(O)C=1C(OCC)=O |
| CAS DataBase Reference | 6975-44-6 |
Description and Uses
Ethyl 4,?6-?dihydroxynicotinate has been used as a reactant is the synthesis of pyridazinopyrimidinone and pyridopyrimidinone derivatives as PDE5 inhibitors and for the synthesis of pyridone diaryl ether non-nucleoside inhibitors of HIV-1 reverse transcriptase.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
