PRODUCT Properties
| Melting point: | 114-116 °C (lit.) |
| form | powder to crystal |
| color | Light yellow to Brown |
| Stability: | Stable. Incompatible with strong oxidizing agents. Hygroscopic. |
| InChI | 1S/C9H12NO2.HI/c1-3-10-6-4-8(5-7-10)9(11)12-2;/h4-7H,3H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | NGEAJXXGUZQCPN-UHFFFAOYSA-M |
| SMILES | [I-].CC[n+]1ccc(cc1)C(=O)OC |
| CAS DataBase Reference | 1199-65-1(CAS DataBase Reference) |
| EPA Substance Registry System | Pyridinium, 1-ethyl-4-(methoxycarbonyl)-, iodide (1199-65-1) |
Description and Uses
1-Ethyl-4-(methoxycarbonyl)pyridinium iodide was employed as probe for micropolarity determinations. It was also used in preparation of 1-ethyl-4-(methoxycarbonyl)pyridinium tetrakis(4-phenoxyphenyl)borate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2933.39.9200 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
