A4050712
Ethyl 2-(Hydroxymethyl)acrylate (stabilized with HQ) , >95.0%(GC) , 10029-04-6
CAS NO.:10029-04-6
Empirical Formula: C6H10O3
Molecular Weight: 130.14
MDL number: MFCD01673859
EINECS: 680-008-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB68.00 | In Stock |
|
| 1g | RMB86.40 | In Stock |
|
| 5G | RMB237.60 | In Stock |
|
| 25G | RMB1023.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 80 °C / 2mmHg |
| Density | 1,07 g/cm3 |
| refractive index | n20/D 1.450 |
| Flash point: | 101°C |
| storage temp. | 2-8°C |
| solubility | Dichloromethane, Ethyl Acetate, Methanol |
| form | Oil |
| pka | 13.69±0.10(Predicted) |
| color | Colourless |
| InChI | InChI=1S/C6H10O3/c1-3-9-6(8)5(2)4-7/h7H,2-4H2,1H3 |
| InChIKey | SYGAXBISYRORDR-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C(CO)=C |
Description and Uses
Ethyl 2-(hydroxymethyl)acrylate is used for the synthesis of aza inhibitors and some potential antitumor agents.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H302-H311-H315-H318 |
| Precautionary statements | P264-P270-P280-P301+P312-P302+P352+P312-P305+P351+P338 |
| Hazard Codes | T |
| Risk Statements | 36/37/38-41-38-24-22 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| RTECS | AT1835000 |
| HS Code | 2918.19.9000 |
| HazardClass | 6.1 |
| PackingGroup | Ⅲ |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






