A4716931
3-Ethoxyacrylic Acid Ethyl Ester , 97% , 1001-26-9
Synonym(s):
Ethyl 3-ethoxy-2-propenoate
CAS NO.:1001-26-9
Empirical Formula: C7H12O3
Molecular Weight: 144.17
MDL number: MFCD00009863
EINECS: 600-029-4
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB39.20 | In Stock |
|
| 5ml | RMB119.20 | In Stock |
|
| 25ml | RMB399.20 | In Stock |
|
| 100ml | RMB1167.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 195-196 °C (lit.) |
| Density | 0.998 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 169 °F |
| storage temp. | 2-8°C |
| form | Liquid |
| color | Colorless |
| Water Solubility | soluble |
| BRN | 1721612 |
| InChI | InChI=1S/C7H12O3/c1-3-9-6-5-7(8)10-4-2/h5-6H,3-4H2,1-2H3 |
| InChIKey | ITQFPVUDTFABDH-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C=COCC |
| CAS DataBase Reference | 1001-26-9(CAS DataBase Reference) |
Description and Uses
Ethyl 3-Ethoxyacrylate is used in the preparation of N-[3-(3-Cyanopyrazolo[1,5-a]pyrimidin-5-yl)phenyl]-N-ethylacetamide, a principal impurity of Zaleplon (Z145000).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-24/25 |
| RIDADR | UN 3334 |
| WGK Germany | 3 |
| F | 19 |
| Hazard Note | Irritant |
| HazardClass | 9 |
| HS Code | 29189900 |




