A4051812
Ethyl 6-Bromohexanoate , >98.0%(GC) , 25542-62-5
Synonym(s):
6-Bromohexanoic acid ethyl ester;Ethyl 6-bromocapronate
CAS NO.：25542-62-5
Empirical Formula: C8H15BrO2
Molecular Weight: 223.11
MDL number: MFCD00000270
EINECS: 247-085-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB35.20 | In Stock |
|
| 25G | RMB83.20 | In Stock |
|
| 100G | RMB249.60 | In Stock |
|
| 500G | RMB1184.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 33°C |
| Boiling point: | 128-130 °C/16 mmHg (lit.) |
| Density | 1.254 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 137 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | Powder or Granular Powder |
| color | White to slightly beige |
| Water Solubility | Soluble in water (water, 64.76 mg/L @ 25°C (est.)). |
| BRN | 1756051 |
| InChI | InChI=1S/C8H15BrO2/c1-2-11-8(10)6-4-3-5-7-9/h2-7H2,1H3 |
| InChIKey | DXBULVYHTICWKT-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)CCCCCBr |
| LogP | 2.690 (est) |
| CAS DataBase Reference | 25542-62-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Ethyl 6-bromohexanoate(25542-62-5) |
Description and Uses
Ethyl 6-bromohexanoate is used in the preparation of various carnitine derivatives in a carnitine transporter study. It is also used for alkylation of pentane-2,4-dione.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| RIDADR | UN 3272 3/PG 3 |
| WGK Germany | 3 |
| F | 19 |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29159000 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
