A4052712
Ethyl 3-Methylcrotonate , >97.0%(GC) , 638-10-8
Synonym(s):
Ethyl 3-methylcrotonate
CAS NO.:638-10-8
Empirical Formula: C7H12O2
Molecular Weight: 128.17
MDL number: MFCD00009187
EINECS: 211-319-1
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB54.40 | In Stock |
|
| 25ML | RMB135.20 | In Stock |
|
| 100ML | RMB452.00 | In Stock |
|
| 500ml | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -62.68°C (estimate) |
| Boiling point: | 154-155 °C (lit.) |
| Density | 0.922 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 93 °F |
| storage temp. | Store at room temperature |
| Water Solubility | Insoluble in water |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Stability: | Stable. Flammable. Incompatible with acids, bases, oxidizing agents, reducing agents. |
| InChI | InChI=1S/C7H12O2/c1-4-9-7(8)5-6(2)3/h5H,4H2,1-3H3 |
| InChIKey | UTXVCHVLDOLVPC-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)/C=C(/C)\C |
| LogP | 2.225 (est) |
| CAS DataBase Reference | 638-10-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Butenoic acid, 3-methyl-, ethyl ester(638-10-8) |
| EPA Substance Registry System | 2-Butenoic acid, 3-methyl-, ethyl ester (638-10-8) |
Description and Uses
Ethyl 3,3-dimethylacrylate was used in the synthesis of:
- 3-benzylmercupto-3-methylbutanoic acid ethylester
- cis-2-cyano-3,3-dimethylcyclopropanecarboxylic acid, precursor for the synthesis of cis-pyrethroids
- 1-[13CD3]-9-cis-retinoic acid
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Warning |
| Hazard statements | H226 |
| Precautionary statements | P501-P240-P210-P233-P243-P241-P242-P280-P370+P378-P303+P361+P353-P403+P235 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-29-33-28-26 |
| RIDADR | UN 3272 3/PG 3 |
| WGK Germany | 2 |
| RTECS | GQ5750000 |
| TSCA | TSCA listed |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 29161900 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






