A4059312
Ethyl 3,5-Dichloro-4-hydroxybenzoate , ≥98.0% , 17302-82-8
CAS NO.:17302-82-8
Empirical Formula: C9H8Cl2O3
Molecular Weight: 235.06
MDL number: MFCD00016420
EINECS: 241-331-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB199.20 | In Stock |
|
| 25G | RMB600.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 98-102 °C |
| Boiling point: | 335.78°C (rough estimate) |
| Density | 1.3965 (rough estimate) |
| refractive index | 1.5000 (estimate) |
| storage temp. | Refrigerator |
| solubility | Soluble in methanol. |
| form | Solid |
| color | White to Off-White |
| BRN | 2649965 |
| InChI | InChI=1S/C9H8Cl2O3/c1-2-14-9(13)5-3-6(10)8(12)7(11)4-5/h3-4,12H,2H2,1H3 |
| InChIKey | WMKNGSJJEMFQOT-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C1=CC(Cl)=C(O)C(Cl)=C1 |
| CAS DataBase Reference | 17302-82-8(CAS DataBase Reference) |
Description and Uses
Ethyl 3,5-dichloro-4-hydroxybenzoate is an important raw material and intermediate used in organic synthesis, pharmaceuticals agrochemicals and dyestuff fields.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H302+H312+H332-H315-H319 |
| Precautionary statements | P280a-P304+P340-P305+P351+P338-P405-P501a-P261-P264-P270-P271-P280-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P305+P351+P338+P337+P313-P501 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| RTECS | DG7503500 |
| Hazard Note | Irritant |
| HS Code | 29163990 |





