A4069512
Ethyl 3-Methylindole-2-carboxylate , >98.0%(GC) , 26304-51-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB276.00 | In Stock |
|
| 5G | RMB1112.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 134-136℃ |
| Boiling point: | 344℃ |
| Density | 1.177 |
| Flash point: | 162℃ |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 15.31±0.30(Predicted) |
| color | Light orange to Yellow to Green |
| λmax | 297nm(EtOH)(lit.) |
| InChI | 1S/C12H13NO2/c1-3-15-12(14)11-8(2)9-6-4-5-7-10(9)13-11/h4-7,13H,3H2,1-2H3 |
| InChIKey | OZQXZSIVKVCSDF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1[nH]c2ccccc2c1C |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| WGK Germany | WGK 3 |
| HS Code | 2933.99.8290 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
