A4069612
4-Ethoxybenzonitrile , >98.0%(GC) , 25117-74-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB201.60 | In Stock |
|
| 25G | RMB639.20 | In Stock |
|
| 100g | RMB2239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 62-64 °C(lit.) |
| Boiling point: | 258 °C(lit.) |
| Density | 1.0921 (rough estimate) |
| refractive index | 1.5309 (estimate) |
| Flash point: | 258°C |
| storage temp. | Store at room temperature |
| form | powder to crystal |
| color | White to Light yellow |
| BRN | 2613602 |
| InChI | InChI=1S/C9H9NO/c1-2-11-9-5-3-8(7-10)4-6-9/h3-6H,2H2,1H3 |
| InChIKey | PJRLUGQMEZZDIY-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(OCC)C=C1 |
| CAS DataBase Reference | 25117-74-2(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H302-H312-H315-H319-H331-H335 |
| Precautionary statements | P261-P280-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2926907090 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
