A4070512
4-Ethynylaniline , >98.0%(HPLC) , 14235-81-5
Synonym(s):
1-Amino-4-ethynylbenzene;P-APAC
| Pack Size | Price | Stock | Quantity |
| 1G | RMB64.80 | In Stock |
|
| 5G | RMB154.40 | In Stock |
|
| 25G | RMB715.20 | In Stock |
|
| 100G | RMB2533.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 98-102 °C (dec.) (lit.) |
| Boiling point: | 99-101 °C(Press: 13 Torr) |
| Density | 1.05±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 3.11±0.10(Predicted) |
| form | Crystalline Powder |
| color | Yellow to brown |
| BRN | 2205181 |
| InChI | InChI=1S/C8H7N/c1-2-7-3-5-8(9)6-4-7/h1,3-6H,9H2 |
| InChIKey | JXYITCJMBRETQX-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(C#C)C=C1 |
| CAS DataBase Reference | 14235-81-5(CAS DataBase Reference) |
Description and Uses
4-Ethynylaniline may be used in the synthesis of N-methyliminodiethyl 4-(4-ethynylphenyliminomethyl)benzeneboronate. It can also be used to prepare an acetylene ligand, HC2-NDI (NDI= 1,4,5,8-naphthalenediimide).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-36/37 |
| WGK Germany | 3 |
| F | 8-10-23 |
| HS Code | 29214990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







