A4147512
2-ethynylaniline , 97% , 52670-38-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB64.00 | In Stock |
|
| 1G | RMB149.60 | In Stock |
|
| 5g | RMB569.60 | In Stock |
|
| 25g | RMB2383.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 87-88 °C |
| Boiling point: | 229-230 °C (lit.) |
| Density | 1.030 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 209 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | clear liquid |
| pka | 1+-.0.10(Predicted) |
| color | Colorless to Light orange to Yellow |
| InChI | InChI=1S/C8H7N/c1-2-7-5-3-4-6-8(7)9/h1,3-6H,9H2 |
| InChIKey | ALQPJHSFIXARGX-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=CC=C1C#C |
Description and Uses
2-Ethynylaniline is an impurity of erlotinib.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2921490090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







