A4081412
Ethyl 2-Fluoroacetoacetate , >95.0%(GC) , 1522-41-4
Synonym(s):
2-Fluoro-3-oxobutanoic acid ethyl ester;Ethyl 2-fluoro-3-oxobutanoate;Ethyl 2-fluoro-3-oxobutyrate;NSC 24563
| Pack Size | Price | Stock | Quantity |
| 5g | RMB135.20 | In Stock |
|
| 25G | RMB382.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 183 °C (lit.) |
| Density | 1.181 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 194 °F |
| storage temp. | Storage temp. 2-8°C |
| pka | 9.25±0.46(Predicted) |
| form | Liquid |
| color | Clear colorless to pale yellow |
| InChI | InChI=1S/C6H9FO3/c1-3-10-6(9)5(7)4(2)8/h5H,3H2,1-2H3 |
| InChIKey | SHTFQLHOTAJQRJ-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C(F)C(=O)C |
| CAS DataBase Reference | 1522-41-4(CAS DataBase Reference) |
Description and Uses
Reactant for:
- Michael addition-induced cyclization reaction
- Asymmetric Mannich reaction
- Enantioselective organocatalytic conjugate addition
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29183000 |




