A4093612
1-Ethynyl-4-(trifluoromethyl)benzene , ≥98% , 705-31-7
| Pack Size | Price | Stock | Quantity |
| 200mg | RMB51.20 | In Stock |
|
| 1G | RMB150.40 | In Stock |
|
| 5G | RMB559.20 | In Stock |
|
| 25g | RMB2171.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 78-80 °C2 mm Hg(lit.) |
| Density | 1.043 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 69 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | Liquid |
| color | Clear colorless to yellow |
| λmax | 249nm(EtOH)(lit.) |
| InChI | InChI=1S/C9H5F3/c1-2-7-3-5-8(6-4-7)9(10,11)12/h1,3-6H |
| InChIKey | XTKBMZQCDBHHKY-UHFFFAOYSA-N |
| SMILES | C1(C#C)=CC=C(C(F)(F)F)C=C1 |
| CAS DataBase Reference | 705-31-7(CAS DataBase Reference) |
Description and Uses
4-Ethynyl-α,α,α-trifluorotoluene may be used to synthesize the following:
- 6,13-bis(4-trifluoromethylphenylethynyl)pentacene
- 1,2-dialkynylimidazoles
- trans-[Co(cyclam)(p-CCC6H4CF3)2]OTf complex (where cyclam - 1,4,8,11-tetraazacyclotetradecane; 4-ethynyl-α,α,α-trifluorotoluene - p-CCC6H4CF3; OTf- trifluoromethane sulfonate)
- 3-spiroazetidinimine-2-oxindoles
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Danger |
| Hazard statements | H225 |
| Precautionary statements | P210 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | F,Xi,F+ |
| Risk Statements | 11 |
| Safety Statements | 16-26-36-45 |
| RIDADR | UN 1993 3/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 3 |
| PackingGroup | Ⅱ |
| HS Code | 29039990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 2 |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |






