PRODUCT Properties
| Melting point: | 77-80 °C (lit.) |
| Boiling point: | 489.9±35.0 °C(Predicted) |
| Density | 1.247±0.06 g/cm3(Predicted) |
| storage temp. | Storage temp. 2-8°C |
| pka | 17.01±0.30(Predicted) |
| Appearance | White to off-white Solid |
| optical activity | [α]20/D +9.9°, c = 1 in ethanol |
| Major Application | peptide synthesis |
| InChI | 1S/C18H18N2O2/c19-16(18(21)22-12-13-6-2-1-3-7-13)10-14-11-20-17-9-5-4-8-15(14)17/h1-9,11,16,20H,10,12,19H2/t16-/m0/s1 |
| InChIKey | TYQYRKDGHAPZRF-INIZCTEOSA-N |
| SMILES | N[C@@H](Cc1c[nH]c2ccccc12)C(=O)OCc3ccccc3 |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P304+P340-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |
