A4112912
Ethyl (3-<WBR>methylbenzoyl)<WBR>acetate , 95% , 33166-79-9
Synonym(s):
3-Oxo-3-(m-tolyl)propionic acid ethyl ester;Ethyl m-methylbenzoylacetate;Ethyl m-toluoylacetate;Ethyl 2-(3-methylbenzoyl)acetate;Ethyl 3-oxo-3-(m-tolyl)propanoate
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB116.80 | In Stock |
|
| 1G | RMB244.80 | In Stock |
|
| 5g | RMB1000.80 | In Stock |
|
| 25g | RMB3576.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 273-274 °C(lit.) |
| Density | 1.083 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| Appearance | Colorless to light yellow Liquid |
| InChI | 1S/C12H14O3/c1-3-15-12(14)8-11(13)10-6-4-5-9(2)7-10/h4-7H,3,8H2,1-2H3 |
| InChIKey | LLFKVNDSLHMEQC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)c1cccc(C)c1 |
| CAS DataBase Reference | 33166-79-9(CAS DataBase Reference) |
Description and Uses
Reactant for:• ;Stereoselective ketonization-olefination of indoles by Co/Mn-mediated oxidative cross-coupling of indoles via dioxygen activation1• ;Enantioselective Michael reaction2• ;SEGPhos-ruthenium-catalyzed asymmetric hydrogenation3
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H319-H315 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| PPE | Eyeshields, Gloves |
| WGK Germany | 3 |
| Storage Class | 10 - Combustible liquids |





